|
gptkbp:instanceOf
|
gptkb:chemical_compound
|
|
gptkbp:CASNumber
|
58-61-7
|
|
gptkbp:component
|
gptkb:ATP
gptkb:cAMP
gptkb:gene
gptkb:ADP
gptkb:FAD
NAD+
|
|
gptkbp:form
|
C10H13N5O4
|
|
gptkbp:foundIn
|
animals
plants
human body
|
|
gptkbp:hasBiologicalActivity
|
sleep regulation
modulation of immune response
regulation of blood flow
inhibition of neurotransmitter release
anti-inflammatory effect
regulation of myocardial oxygen consumption
|
|
gptkbp:hasInChIKey
|
OIRDTQYFTABQOQ-KQYNXXCUSA-N
|
|
gptkbp:hasRole
|
gptkb:immunotherapy
gptkb:vasodilator
gptkb:neurotransmitter
|
|
gptkbp:hasSMILES
|
C1=NC2=C(N1)N=CN2C3C(C(C(O3)CO)O)O
|
|
gptkbp:involvedIn
|
signal transduction
cell signaling
energy transfer
vasodilation
purine metabolism
cardiac function regulation
nucleic acid synthesis
sleep-wake cycle regulation
|
|
gptkbp:isDegradedBy
|
gptkb:adenosine_deaminase
|
|
gptkbp:IUPACName
|
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
|
|
gptkbp:KEGGID
|
gptkb:C00242
|
|
gptkbp:molecularWeight
|
267.24 g/mol
|
|
gptkbp:name
|
gptkb:Adenosine
|
|
gptkbp:predecessor
|
gptkb:adenosine_triphosphate
gptkb:cyclic_adenosine_monophosphate
gptkb:adenosine_diphosphate
adenosine monophosphate
|
|
gptkbp:producedBy
|
gptkb:adenosine_kinase
|
|
gptkbp:PubChem_CID
|
16335
60961
|
|
gptkbp:target
|
gptkb:adenosine_receptors
|
|
gptkbp:usedFor
|
pharmaceutical agent
|
|
gptkbp:bfsParent
|
gptkb:Guanine
|
|
gptkbp:bfsLayer
|
6
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
C00242
|