| gptkbp:instanceOf | gptkb:receptor_tyrosine_kinase gptkb:drug
 
 | 
                        
                            
                                | gptkbp:administeredBy | oral 
 | 
                        
                            
                                | gptkbp:approvalYear | 2013 
 | 
                        
                            
                                | gptkbp:approvedBy | gptkb:FDA gptkb:EMA
 
 | 
                        
                            
                                | gptkbp:ATCCode | L01EB03 
 | 
                        
                            
                                | gptkbp:bioavailability | 92% 
 | 
                        
                            
                                | gptkbp:brand | gptkb:Gilotrif gptkb:Giotrif
 
 | 
                        
                            
                                | gptkbp:CASNumber | 439081-18-2 
 | 
                        
                            
                                | gptkbp:category | gptkb:protease_inhibitor gptkb:antineoplastic_agent
 quinazoline derivative
 
 | 
                        
                            
                                | gptkbp:contraindication | hypersensitivity to afatinib 
 | 
                        
                            
                                | gptkbp:developedBy | gptkb:Boehringer_Ingelheim 
 | 
                        
                            
                                | gptkbp:discoveredBy | gptkb:Boehringer_Ingelheim 
 | 
                        
                            
                                | gptkbp:eliminationHalfLife | 37 hours 
 | 
                        
                            
                                | gptkbp:excretion | urine feces
 
 | 
                        
                            
                                | gptkbp:hasMolecularFormula | C24H25ClFN5O3 
 | 
                        
                            
                                | gptkbp:hasSMILES | COC1=CC2=C(C=C1)N=C(NC3=CC=C(C=C3)F)N2CC4=CC=C(C=C4)Cl 
 | 
                        
                            
                                | gptkbp:interactsWith | P-glycoprotein inducers P-glycoprotein inhibitors
 
 | 
                        
                            
                                | gptkbp:KEGGID | D09722 
 | 
                        
                            
                                | gptkbp:legalStatus | prescription only 
 | 
                        
                            
                                | gptkbp:mechanismOfAction | irreversible inhibitor of EGFR and HER2 
 | 
                        
                            
                                | gptkbp:metabolism | minimal hepatic metabolism 
 | 
                        
                            
                                | gptkbp:patentExpired | 2024 (US) 
 | 
                        
                            
                                | gptkbp:pregnancyCategory | D (US) 
 | 
                        
                            
                                | gptkbp:pregnancyWarning | may cause fetal harm 
 | 
                        
                            
                                | gptkbp:proteinBinding | 95% 
 | 
                        
                            
                                | gptkbp:PubChem_CID | gptkb:CHEMBL1173655 gptkb:DB08916
 10184653
 
 | 
                        
                            
                                | gptkbp:routeOfAdministration | oral 
 | 
                        
                            
                                | gptkbp:sideEffect | diarrhea rash
 stomatitis
 paronychia
 
 | 
                        
                            
                                | gptkbp:synonym | gptkb:BIBW_2992 
 | 
                        
                            
                                | gptkbp:target | gptkb:EGFR HER2
 
 | 
                        
                            
                                | gptkbp:UNII | J2U8A8C830 
 | 
                        
                            
                                | gptkbp:usedFor | gptkb:non-small_cell_lung_cancer metastatic lung cancer
 
 | 
                        
                            
                                | gptkbp:bfsParent | gptkb:Non-Small_Cell_Lung_Cancer 
 | 
                        
                            
                                | gptkbp:bfsLayer | 6 
 | 
                        
                            
                                | https://www.w3.org/2000/01/rdf-schema#label | Afatinib 
 |