Statements (28)
| Predicate | Object |
|---|---|
| gptkbp:instanceOf |
gptkb:benzophenanthridine_alkaloid
gptkb:alkaloid |
| gptkbp:CASNumber |
476-32-4
|
| gptkbp:charge |
+1
|
| gptkbp:chemicalFormula |
C21H18NO4+
|
| gptkbp:color |
yellow
|
| gptkbp:drugClass |
gptkb:antibiotic
gptkb:cytotoxic_agent protein kinase C inhibitor |
| gptkbp:foundIn |
gptkb:Chelidonium_majus
gptkb:Bocconia_frutescens gptkb:Zanthoxylum_clava-herculis |
| gptkbp:hasInChIKey |
JYJCFQKZBHPUQO-UHFFFAOYSA-O
|
| gptkbp:hasSMILES |
C[N+]1=CC2=C(C=C1)C3=CC4=C(C=C3OC2)OCO4
|
| gptkbp:isSolubleIn |
gptkb:water
gptkb:chloroform ethanol |
| gptkbp:IUPACName |
2,3-methylenedioxy-13-methyl-(5,6,7,8-tetrahydro)benzo[c]phenanthridinium
|
| gptkbp:meltingPoint |
>300°C
|
| gptkbp:molecularWeight |
348.37 g/mol
|
| gptkbp:PubChem_CID |
72313
CHEBI:3538 |
| gptkbp:usedFor |
fluorescent probe
|
| gptkbp:usedIn |
biochemical research
|
| gptkbp:bfsParent |
gptkb:PKCα
gptkb:PKC |
| gptkbp:bfsLayer |
7
|
| https://www.w3.org/2000/01/rdf-schema#label |
chelerythrine
|