| gptkbp:instanceOf | gptkb:drug gptkb:cyclin-dependent_kinase_inhibitor
 
 | 
                        
                            
                                | gptkbp:administeredBy | oral 
 | 
                        
                            
                                | gptkbp:approvalYear | 2015 
 | 
                        
                            
                                | gptkbp:approvedBy | gptkb:FDA gptkb:EMA
 
 | 
                        
                            
                                | gptkbp:ATCCode | L01EF01 
 | 
                        
                            
                                | gptkbp:brand | gptkb:Ibrance 
 | 
                        
                            
                                | gptkbp:CASNumber | gptkb:571190-30-2 
 | 
                        
                            
                                | gptkbp:chemicalClass | pyridopyrimidine 
 | 
                        
                            
                                | gptkbp:color | white to yellow powder 
 | 
                        
                            
                                | gptkbp:combines | gptkb:fulvestrant gptkb:letrozole
 
 | 
                        
                            
                                | gptkbp:contraindication | hypersensitivity to palbociclib 
 | 
                        
                            
                                | gptkbp:developedBy | gptkb:Pfizer 
 | 
                        
                            
                                | gptkbp:discoveredBy | gptkb:Pfizer 
 | 
                        
                            
                                | gptkbp:eliminationHalfLife | 29 hours 
 | 
                        
                            
                                | gptkbp:excretion | urine feces
 
 | 
                        
                            
                                | gptkbp:hasMolecularFormula | C24H29N7O2 
 | 
                        
                            
                                | gptkbp:hasSMILES | CC1=CC(=NC(=N1)N2CCN(CC2)C3=NC4=C(C=CC(=C4N3)C)C(=O)NC5=CC=CC=C5)C(=O)N 
 | 
                        
                            
                                | gptkbp:indication | HR-positive, HER2-negative advanced or metastatic breast cancer 
 | 
                        
                            
                                | gptkbp:interactsWith | CYP3A inducers CYP3A inhibitors
 
 | 
                        
                            
                                | gptkbp:KEGGID | D09913 
 | 
                        
                            
                                | gptkbp:lactationWarning | not recommended during breastfeeding 
 | 
                        
                            
                                | gptkbp:legalStatus | prescription only 
 | 
                        
                            
                                | gptkbp:mechanismOfAction | inhibits cell cycle progression 
 | 
                        
                            
                                | gptkbp:metabolism | liver 
 | 
                        
                            
                                | gptkbp:patent | gptkb:Pfizer 
 | 
                        
                            
                                | gptkbp:patentExpired | 2023 (US) 
 | 
                        
                            
                                | gptkbp:pregnancyCategory | D (US) 
 | 
                        
                            
                                | gptkbp:pregnancyWarning | may cause fetal harm 
 | 
                        
                            
                                | gptkbp:proteinBinding | 85% 
 | 
                        
                            
                                | gptkbp:PubChem_CID | gptkb:CHEMBL1899636 5330286
 DB09073
 
 | 
                        
                            
                                | gptkbp:routeOfAdministration | oral 
 | 
                        
                            
                                | gptkbp:sideEffect | nausea fatigue
 alopecia
 neutropenia
 leukopenia
 
 | 
                        
                            
                                | gptkbp:solubility | slightly soluble in water 
 | 
                        
                            
                                | gptkbp:target | gptkb:CDK4 gptkb:CDK6
 
 | 
                        
                            
                                | gptkbp:UNII | 8N3DW7272P 
 | 
                        
                            
                                | gptkbp:usedFor | gptkb:cancer 
 | 
                        
                            
                                | gptkbp:bfsParent | gptkb:Cdk4 gptkb:Serine/threonine-protein_kinase_CDK4
 
 | 
                        
                            
                                | gptkbp:bfsLayer | 8 
 | 
                        
                            
                                | https://www.w3.org/2000/01/rdf-schema#label | Palbociclib 
 |