|
gptkbp:instanceOf
|
gptkb:analgesic
gptkb:opioid
|
|
gptkbp:antidote
|
gptkb:naloxone
gptkb:naltrexone
|
|
gptkbp:associatedWith
|
opioid epidemic
synthetic opioid crisis
|
|
gptkbp:ATCCode
|
N01AH
|
|
gptkbp:binds
|
gptkb:mu-opioid_receptor
|
|
gptkbp:CASNumber
|
59708-52-0
|
|
gptkbp:chemicalFormula
|
C24H30N2O3
|
|
gptkbp:compatibleWith
|
human use
|
|
gptkbp:detects
|
toxicology screening
|
|
gptkbp:discoveredBy
|
gptkb:Paul_Janssen
|
|
gptkbp:discoveredIn
|
1974
|
|
gptkbp:hasInChIKey
|
YQKQYVJVQWQZEB-UHFFFAOYSA-N
|
|
gptkbp:hasPotency
|
about 10,000 times more potent than morphine
about 100 times more potent than fentanyl
|
|
gptkbp:hasSMILES
|
CCC(=O)N(C1CCN(CC1)CC2=CC=CC=C2)C3=CC=CC=C3C(=O)OC
|
|
gptkbp:hasUNII
|
UQN4C7GNSN
|
|
gptkbp:isAbusedAs
|
gptkb:recreational_drug
|
|
gptkbp:isHighlyToxicTo
|
animals
humans
|
|
gptkbp:isNotMarketedFor
|
human use
|
|
gptkbp:isUsedIllegallyAs
|
cutting agent in street drugs
|
|
gptkbp:IUPACName
|
methyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate
|
|
gptkbp:KEGGID
|
D03441
|
|
gptkbp:legalStatus
|
Class A drug (UK)
Schedule II controlled substance (US)
Schedule I controlled substance (Canada)
|
|
gptkbp:marketedAs
|
Wildnil (veterinary use)
|
|
gptkbp:molecularWeight
|
394.51 g/mol
|
|
gptkbp:parent
|
fentanyl
|
|
gptkbp:PubChem_CID
|
gptkb:DB01535
56473
CHEMBL2104702
62737
|
|
gptkbp:relatedTo
|
gptkb:morphine
gptkb:opioid
gptkb:amphetamine
gptkb:remifentanil
fentanyl
alfentanil
sufentanil
|
|
gptkbp:riskFactor
|
high risk of accidental overdose
|
|
gptkbp:routeOfAdministration
|
injection
oral
transdermal
|
|
gptkbp:sideEffect
|
gptkb:death
overdose
respiratory depression
|
|
gptkbp:usedFor
|
veterinary anesthesia
|
|
gptkbp:usedOn
|
large animals (e.g., elephants)
|
|
gptkbp:bfsParent
|
gptkb:FZ201
gptkb:WL-10
|
|
gptkbp:bfsLayer
|
8
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
carfentanil
|