carfentanil

GPTKB entity

Statements (56)
Predicate Object
gptkbp:instanceOf gptkb:analgesic
gptkb:opioid
gptkbp:antidote gptkb:naloxone
gptkb:naltrexone
gptkbp:associatedWith opioid epidemic
synthetic opioid crisis
gptkbp:ATCCode N01AH
gptkbp:binds gptkb:mu-opioid_receptor
gptkbp:CASNumber 59708-52-0
gptkbp:chemicalFormula C24H30N2O3
gptkbp:compatibleWith human use
gptkbp:detects toxicology screening
gptkbp:discoveredBy gptkb:Paul_Janssen
gptkbp:discoveredIn 1974
gptkbp:hasInChIKey YQKQYVJVQWQZEB-UHFFFAOYSA-N
gptkbp:hasPotency about 10,000 times more potent than morphine
about 100 times more potent than fentanyl
gptkbp:hasSMILES CCC(=O)N(C1CCN(CC1)CC2=CC=CC=C2)C3=CC=CC=C3C(=O)OC
gptkbp:hasUNII UQN4C7GNSN
gptkbp:isAbusedAs gptkb:recreational_drug
gptkbp:isHighlyToxicTo animals
humans
gptkbp:isNotMarketedFor human use
gptkbp:isUsedIllegallyAs cutting agent in street drugs
gptkbp:IUPACName methyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate
gptkbp:KEGGID D03441
gptkbp:legalStatus Class A drug (UK)
Schedule II controlled substance (US)
Schedule I controlled substance (Canada)
gptkbp:marketedAs Wildnil (veterinary use)
gptkbp:molecularWeight 394.51 g/mol
gptkbp:parent fentanyl
gptkbp:PubChem_CID gptkb:DB01535
56473
CHEMBL2104702
62737
gptkbp:relatedTo gptkb:morphine
gptkb:opioid
gptkb:amphetamine
gptkb:remifentanil
fentanyl
alfentanil
sufentanil
gptkbp:riskFactor high risk of accidental overdose
gptkbp:routeOfAdministration injection
oral
transdermal
gptkbp:sideEffect gptkb:death
overdose
respiratory depression
gptkbp:usedFor veterinary anesthesia
gptkbp:usedOn large animals (e.g., elephants)
gptkbp:bfsParent gptkb:FZ201
gptkb:WL-10
gptkbp:bfsLayer 8
https://www.w3.org/2000/01/rdf-schema#label carfentanil