|
gptkbp:instanceOf
|
gptkb:chemical_compound
gptkb:opioid
|
|
gptkbp:CASNumber
|
73986-58-8
|
|
gptkbp:contains_functional_group
|
gptkb:phenol
gptkb:secondary_alcohol
gptkb:tertiary_amine
|
|
gptkbp:drugClass
|
gptkb:analgesic
mu-opioid receptor agonist
|
|
gptkbp:has_parent_compound
|
gptkb:tramadol
|
|
gptkbp:hasInChIKey
|
QZVZEKZQGJFQDC-UXBLZVDNSA-N
|
|
gptkbp:hasMolecularFormula
|
C16H25NO2
|
|
gptkbp:hasSMILES
|
CN(C)CC[C@H]1CC[C@H](C1)C2=CC(=CC=C2)O
|
|
gptkbp:is_active_metabolite_of
|
gptkb:tramadol
|
|
gptkbp:is_enantiomer
|
(+)O-desmethyltramadol
(-)O-desmethyltramadol
|
|
gptkbp:IUPACName
|
(1R,2R)-2-[(dimethylamino)methyl]-1-(3-hydroxyphenyl)cyclohexanol
|
|
gptkbp:legalStatus
|
controlled substance in some countries
|
|
gptkbp:metabolism
|
gptkb:tramadol
|
|
gptkbp:molecularWeight
|
263.38 g/mol
|
|
gptkbp:PubChem_CID
|
gptkb:CHEMBL2103837
9837242
|
|
gptkbp:relatedTo
|
gptkb:tapentadol
gptkb:tramadol
desmetramadol
|
|
gptkbp:routeOfAdministration
|
oral
intramuscular
subcutaneous
intravenous
|
|
gptkbp:UNII
|
6KZ8R1ZE1S
|
|
gptkbp:bfsParent
|
gptkb:tramadol
|
|
gptkbp:bfsLayer
|
8
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
O-desmethyltramadol
|