|
gptkbp:instanceOf
|
gptkb:drug
|
|
gptkbp:approvalYear
|
2004
|
|
gptkbp:approvedBy
|
gptkb:FDA
gptkb:EMA
gptkb:Health_Canada
|
|
gptkbp:ATCCode
|
gptkb:N06AX21
|
|
gptkbp:bioavailability
|
50%
|
|
gptkbp:brand
|
gptkb:Cymbalta
gptkb:Drizalma_Sprinkle
Irenka
|
|
gptkbp:CASNumber
|
gptkb:136434-34-9
|
|
gptkbp:category
|
gptkb:antidepressant
gptkb:norepinephrine_reuptake_inhibitor
gptkb:benzodiazepine
|
|
gptkbp:contraindication
|
uncontrolled narrow-angle glaucoma
concurrent use with MAOIs
|
|
gptkbp:drugInteraction
|
gptkb:MAO_inhibitors
CYP2D6 inhibitors
CYP1A2 inhibitors
|
|
gptkbp:eliminationHalfLife
|
12 hours
|
|
gptkbp:excretion
|
urine
|
|
gptkbp:genericAvailable
|
yes
|
|
gptkbp:hasInChIKey
|
PTFQOBMPAATQMB-UHFFFAOYSA-N
|
|
gptkbp:hasMolecularFormula
|
gptkb:C18H19NOS
|
|
gptkbp:hasPatentExpiry
|
2013 (US)
|
|
gptkbp:hasSMILES
|
CN(C)CCOC1=CC=CC=C1C2=CC=CC=C2S
|
|
gptkbp:hasUNII
|
O5TNM5N07U
|
|
gptkbp:indication
|
gptkb:generalized_anxiety_disorder
gptkb:major_depressive_disorder
fibromyalgia
chronic musculoskeletal pain
diabetic peripheral neuropathic pain
|
|
gptkbp:legalStatus
|
prescription only
|
|
gptkbp:mechanismOfAction
|
serotonin and norepinephrine reuptake inhibitor
|
|
gptkbp:metabolism
|
hepatic (CYP1A2, CYP2D6)
|
|
gptkbp:molecularWeight
|
297.42
|
|
gptkbp:name
|
gptkb:Duloxetine
|
|
gptkbp:pregnancyCategory
|
C (US)
|
|
gptkbp:proteinBinding
|
95%
|
|
gptkbp:PubChem_CID
|
gptkb:DB01242
60835
CHEMBL117
D07861
|
|
gptkbp:routeOfAdministration
|
oral
|
|
gptkbp:sideEffect
|
nausea
constipation
dry mouth
somnolence
decreased appetite
hyperhidrosis
|
|
gptkbp:target
|
SLC6A2 (norepinephrine transporter)
SLC6A4 (serotonin transporter)
|
|
gptkbp:bfsParent
|
gptkb:Clomipramine
|
|
gptkbp:bfsLayer
|
7
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
DB01242
|