Statements (28)
| Predicate | Object |
|---|---|
| gptkbp:instanceOf |
gptkb:organophosphite_compound
|
| gptkbp:appearance |
colorless liquid
|
| gptkbp:boilingPoint |
360 °C
|
| gptkbp:CASNumber |
101-02-0
|
| gptkbp:chemicalFormula |
C18H15O3P
|
| gptkbp:containsElement |
gptkb:phosphorus
carbon hydrogen oxygen |
| gptkbp:density |
1.183 g/cm³
|
| gptkbp:hasInChIKey |
QXJRBVBLJISWMS-UHFFFAOYSA-N
|
| gptkbp:hasSMILES |
O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1
|
| gptkbp:IUPACName |
gptkb:triphenyl_phosphite
|
| gptkbp:meltingPoint |
19 °C
|
| gptkbp:molecularWeight |
310.28 g/mol
|
| gptkbp:relatedTo |
gptkb:triphenylphosphine
gptkb:phosphorous_acid |
| gptkbp:riskFactor |
H315
H319 H335 |
| gptkbp:solubility |
insoluble
|
| gptkbp:structureType |
phosphite ester
|
| gptkbp:uses |
gptkb:antioxidant
ligand in organometallic chemistry stabilizer in polymers |
| gptkbp:bfsParent |
gptkb:triphenylphosphine
|
| gptkbp:bfsLayer |
7
|
| https://www.w3.org/2000/01/rdf-schema#label |
triphenylphosphite
|