triphenyl phosphite

GPTKB entity

Statements (28)
Predicate Object
gptkbp:instanceOf gptkb:chemical_compound
gptkb:organophosphite_compound
gptkbp:appearance colorless liquid
gptkbp:boilingPoint 360 °C
gptkbp:CASNumber 101-02-0
gptkbp:category phosphorus compounds
phenol esters
gptkbp:chemicalFormula C18H15O3P
gptkbp:density 1.183 g/cm³
gptkbp:EC_number 202-908-4
gptkbp:hasInChIKey QXJRBVBLJISWMA-UHFFFAOYSA-N
gptkbp:hasSMILES O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1
gptkbp:IUPACName triphenoxyphosphane
gptkbp:meltingPoint -20 °C
gptkbp:molecularWeight 310.28 g/mol
gptkbp:PubChem_CID 6626
gptkbp:relatedTo phosphite esters
triphenyl phosphate
gptkbp:riskFactor irritant
gptkbp:solubility insoluble
soluble in organic solvents
gptkbp:structure phosphorus atom bonded to three phenoxy groups
gptkbp:uses gptkb:antioxidant
ligand in organometallic chemistry
stabilizer in plastics
gptkbp:bfsParent gptkb:triphenylphosphite
gptkbp:bfsLayer 8
https://www.w3.org/2000/01/rdf-schema#label triphenyl phosphite