UNC0638

GPTKB entity

Statements (18)
Predicate Object
gptkbp:instanceOf gptkb:chemical_compound
gptkbp:CASNumber 1255580-76-7
gptkbp:hasMolecularFormula C18H23N7O
gptkbp:hasSMILES CNc1cc(NC(=O)c2ccc(NCCCN(C)C)cc2)ncn1
gptkbp:inhibitedBy gptkb:GLP
gptkb:G9a
gptkbp:is_cell-permeable true
gptkbp:is_selective_for G9a/GLP histone methyltransferases
gptkbp:IUPACName N-(3-(dimethylamino)propyl)-4-(6-(methylamino)pyrimidin-4-ylamino)benzamide
gptkbp:mechanismOfAction inhibits histone H3 lysine 9 methylation
gptkbp:molecularWeight 353.42 g/mol
gptkbp:PubChem_CID 46224516
CHEMBL1800375
gptkbp:used_in epigenetics research
gptkbp:usedFor chemical probe
gptkbp:bfsParent gptkb:SETDB1
gptkbp:bfsLayer 8
https://www.w3.org/2000/01/rdf-schema#label UNC0638