Statements (26)
| Predicate | Object |
|---|---|
| gptkbp:instanceOf |
gptkb:drug
|
| gptkbp:ATCCode |
gptkb:J05AP08
|
| gptkbp:bioavailability |
~92%
|
| gptkbp:CASNumber |
1190307-88-0
|
| gptkbp:halfLife |
0.4 hours (sofosbuvir), 27 hours (GS-331007 metabolite)
|
| gptkbp:hasEliminationRoute |
Renal
|
| gptkbp:hasMolecularFormula |
C22H29FN3O9P
|
| gptkbp:hasSMILES |
CC(C)COC(=O)[C@H](NC(=O)[C@H](F)P(=O)(OCC1=CN=CN1C)OCC2=CC=CC=C2)OCC3=CN=CN3C
|
| gptkbp:indication |
treatment of chronic hepatitis C infection
|
| gptkbp:legalStatus |
prescription only
|
| gptkbp:manufacturer |
gptkb:Gilead_Sciences
|
| gptkbp:mechanismOfAction |
NS5B RNA-dependent RNA polymerase inhibitor
|
| gptkbp:metabolism |
Hepatic
|
| gptkbp:molecularWeight |
529.45
|
| gptkbp:name |
gptkb:Sofosbuvir
|
| gptkbp:proteinBinding |
61-65%
|
| gptkbp:PubChem_CID |
gptkb:DB08912
|
| gptkbp:routeOfAdministration |
oral
|
| gptkbp:status |
true
|
| gptkbp:synonym |
gptkb:Sovaldi
gptkb:GS-7977 gptkb:PSI-7977 |
| gptkbp:target |
NS5B polymerase
|
| gptkbp:bfsParent |
gptkb:dabrafenib
|
| gptkbp:bfsLayer |
6
|
| https://www.w3.org/2000/01/rdf-schema#label |
DB08912
|