Statements (18)
| Predicate | Object |
|---|---|
| gptkbp:instanceOf |
gptkb:chemical_compound
|
| gptkbp:hasAssay |
inhibitor
|
| gptkbp:hasInChIKey |
gptkb:QJQJQJQJQJQJQJ-UHFFFAOYSA-N
|
| gptkbp:hasMolecularFormula |
C17H19N3O3
|
| gptkbp:hasSMILES |
COC1=CC=C(C=C1)NC(=O)C(=O)C2=CN(C3=CC=CC=C32)C
|
| gptkbp:hasStandardType |
IC50
|
| gptkbp:hasStandardUnits |
μM
|
| gptkbp:hasStandardValue |
0.13
|
| gptkbp:isBioactive |
true
|
| gptkbp:molecularWeight |
313.35
|
| gptkbp:organism |
gptkb:Homo_sapiens
|
| gptkbp:PubChem_CID |
gptkb:CHEMBL2103886
|
| gptkbp:supportsDataSource |
gptkb:ChEMBL
|
| gptkbp:synonym |
N-(4-methoxyphenyl)-2-(1-methyl-1H-indol-3-yl)-2-oxoacetamide
|
| gptkbp:target |
gptkb:Indoleamine_2,3-dioxygenase_1
|
| gptkbp:bfsParent |
gptkb:indoximod
|
| gptkbp:bfsLayer |
8
|
| https://www.w3.org/2000/01/rdf-schema#label |
CHEMBL2103886
|