|
gptkbp:instanceOf
|
gptkb:chemical_compound
|
|
gptkbp:ATCCode
|
gptkb:R06AX13
|
|
gptkbp:bioavailability
|
40%
|
|
gptkbp:CASNumber
|
79794-75-5
|
|
gptkbp:eliminationHalfLife
|
8 hours
|
|
gptkbp:hasChEMBLId
|
gptkb:CHEMBL1533
|
|
gptkbp:hasHydrogenBondAcceptors
|
4
|
|
gptkbp:hasHydrogenBondDonors
|
0
|
|
gptkbp:hasInChIKey
|
QFXYQZPCLHVESH-UHFFFAOYSA-N
|
|
gptkbp:hasLogP
|
5.2
|
|
gptkbp:hasMolecularFormula
|
gptkb:C22H23ClN2O2
|
|
gptkbp:hasRotatableBonds
|
6
|
|
gptkbp:hasSMILES
|
CCOC(=O)N1CCC(C2=CC=CC=C2C3=CC=CC=C3Cl)=C1
|
|
gptkbp:hasTPSA
|
49.33 Ų
|
|
gptkbp:hasUNII
|
J60AR2IKIC
|
|
gptkbp:indication
|
allergic rhinitis
urticaria
|
|
gptkbp:isApprovedDrug
|
true
|
|
gptkbp:IUPACName
|
ethyl 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)piperidine-1-carboxylate
|
|
gptkbp:legalStatus
|
gptkb:OTC
|
|
gptkbp:listedOn
|
gptkb:Wikipedia
gptkb:PubChem
gptkb:ChEBI
gptkb:DrugBank
gptkb:KEGG
|
|
gptkbp:mechanismOfAction
|
histamine H1 receptor antagonist
|
|
gptkbp:meltingPoint
|
134-137°C
|
|
gptkbp:metabolism
|
gptkb:desloratadine
liver (CYP3A4, CYP2D6)
|
|
gptkbp:molecularWeight
|
382.88
|
|
gptkbp:name
|
gptkb:loratadine
|
|
gptkbp:pregnancyCategory
|
B (US)
|
|
gptkbp:PubChem_CID
|
gptkb:D08170
gptkb:DB00455
3957
CHEBI:6541
|
|
gptkbp:routeOfAdministration
|
oral
|
|
gptkbp:sideEffect
|
headache
drowsiness
dry mouth
|
|
gptkbp:synonym
|
gptkb:Claritin
gptkb:Alavert
Loratadinum
Sch 29851
|
|
gptkbp:target
|
gptkb:HRH1
|
|
gptkbp:bfsParent
|
gptkb:meperidine
|
|
gptkbp:bfsLayer
|
8
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
CHEMBL1533
|