|
gptkbp:instanceOf
|
gptkb:chemical_compound
|
|
gptkbp:approvedBy
|
1976
true
|
|
gptkbp:ATCCode
|
gptkb:C07AB03
|
|
gptkbp:bioavailability
|
50% (oral)
|
|
gptkbp:CASNumber
|
gptkb:29122-68-7
|
|
gptkbp:category
|
gptkb:beta_blocker
gptkb:antihypertensive_agent
antianginal agent
cardiovascular drug
|
|
gptkbp:contraindication
|
asthma
severe bradycardia
cardiogenic shock
|
|
gptkbp:drug_type
|
gptkb:small_molecule
|
|
gptkbp:eliminationHalfLife
|
urine
6-7 hours
|
|
gptkbp:excretion
|
renal
|
|
gptkbp:hasInChIKey
|
METKIMKYRPQLGS-UHFFFAOYSA-N
|
|
gptkbp:hasLogP
|
0.16
|
|
gptkbp:hasMolecularFormula
|
C14H22N2O3
|
|
gptkbp:hasSMILES
|
CC(C)NCC(CO)OC1=CC=C(C=C1)C(=O)N
|
|
gptkbp:indication
|
myocardial infarction
hypertension
angina pectoris
|
|
gptkbp:IUPACName
|
gptkb:4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzamide
|
|
gptkbp:KEGGID
|
gptkb:D00222
|
|
gptkbp:legalStatus
|
prescription only
|
|
gptkbp:mechanismOfAction
|
beta-1 adrenergic receptor antagonist
|
|
gptkbp:meltingPoint
|
152-155°C
|
|
gptkbp:metabolism
|
minimal hepatic
|
|
gptkbp:molecularWeight
|
266.34
|
|
gptkbp:name
|
gptkb:Atenolol
|
|
gptkbp:origin
|
synthetic
|
|
gptkbp:pKa
|
9.6
|
|
gptkbp:proteinBinding
|
6-16%
|
|
gptkbp:PubChem_CID
|
gptkb:CHEMBL108
CHEBI:2269
DB00335
2249
|
|
gptkbp:routeOfAdministration
|
oral
|
|
gptkbp:sideEffect
|
dizziness
fatigue
bradycardia
cold extremities
|
|
gptkbp:synonym
|
gptkb:Atenololum
gptkb:Tenormin
|
|
gptkbp:target
|
beta-1 adrenergic receptor
|
|
gptkbp:UNII
|
50VV3VW0TI
|
|
gptkbp:bfsParent
|
gptkb:Limonene
|
|
gptkbp:bfsLayer
|
6
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
CHEMBL108
|