| gptkbp:instanceOf | gptkb:fat gptkb:carboxylic_acid
 
 | 
                        
                            
                                | gptkbp:appearance | colorless to pale yellow liquid 
 | 
                        
                            
                                | gptkbp:aroma | unpleasant, rancid-like odor 
 | 
                        
                            
                                | gptkbp:boilingPoint | 239.7 °C 
 | 
                        
                            
                                | gptkbp:CASNumber | 124-07-2 
 | 
                        
                            
                                | gptkbp:chemicalFormula | C8H16O2 
 | 
                        
                            
                                | gptkbp:commonName | gptkb:caprylic_acid 
 | 
                        
                            
                                | gptkbp:density | 0.910 g/cm³ 
 | 
                        
                            
                                | gptkbp:foundIn | coconut oil palm kernel oil
 milk of various mammals
 
 | 
                        
                            
                                | gptkbp:hasInChIKey | InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10) 
 | 
                        
                            
                                | gptkbp:hasSMILES | CCCCCCCC(=O)O 
 | 
                        
                            
                                | gptkbp:IUPACName | gptkb:octanoic_acid 
 | 
                        
                            
                                | gptkbp:KEGGID | C06424 
 | 
                        
                            
                                | gptkbp:meltingPoint | 16.3 °C 
 | 
                        
                            
                                | gptkbp:molecularWeight | 144.21 g/mol 
 | 
                        
                            
                                | gptkbp:PubChem_CID | 379 28837
 CHEMBL15812
 
 | 
                        
                            
                                | gptkbp:riskFactor | causes serious eye irritation causes skin irritation
 
 | 
                        
                            
                                | gptkbp:solubility | slightly soluble 
 | 
                        
                            
                                | gptkbp:UNII | 6T8X9NS3NP 
 | 
                        
                            
                                | gptkbp:uses | gptkb:antibiotic manufacture of perfumes
 production of dyes
 synthesis of esters
 
 | 
                        
                            
                                | gptkbp:bfsParent | gptkb:2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic_acid 
 | 
                        
                            
                                | gptkbp:bfsLayer | 7 
 | 
                        
                            
                                | https://www.w3.org/2000/01/rdf-schema#label | octanoic acid 
 |