|
gptkbp:instanceOf
|
gptkb:chemical_compound
gptkb:Polycyclic_aromatic_hydrocarbon
gptkb:Aromatic_hydrocarbon
|
|
gptkbp:appearance
|
White crystalline solid
|
|
gptkbp:aroma
|
Characteristic odor (mothballs)
|
|
gptkbp:autoignitionTemperature
|
526 °C
|
|
gptkbp:biodegradable
|
Biodegradable under certain conditions
|
|
gptkbp:boilingPoint
|
218 °C
|
|
gptkbp:CASNumber
|
91-20-3
|
|
gptkbp:chemicalFormula
|
gptkb:C10H8
|
|
gptkbp:commonName
|
gptkb:Mothballs
|
|
gptkbp:crystalSystem
|
Monoclinic
|
|
gptkbp:density
|
1.14 g/cm³
|
|
gptkbp:discoveredBy
|
gptkb:John_Kidd
|
|
gptkbp:discoveredIn
|
1819
|
|
gptkbp:EC_number
|
202-049-5
|
|
gptkbp:environmentalHazard
|
Toxic to aquatic organisms
|
|
gptkbp:flammability
|
Flammable solid
|
|
gptkbp:flashPoint
|
80 °C
|
|
gptkbp:GHS_signal_word
|
Warning
|
|
gptkbp:hasInChIKey
|
UFWIBTONFRDIAS-UHFFFAOYSA-N
InChI=1S/C10H8/c1-2-4-8-6-10(5-3-1)9-7-8/h1-8H
|
|
gptkbp:hasSMILES
|
c1ccc2ccccc2c1
|
|
gptkbp:IUPACName
|
gptkb:Naphthalene
|
|
gptkbp:KEGGID
|
C06518
|
|
gptkbp:LD50
|
490 mg/kg (oral, rat)
|
|
gptkbp:meltingPoint
|
80.2 °C
|
|
gptkbp:MeSH_ID
|
D009292
|
|
gptkbp:metabolism
|
Metabolized in liver
|
|
gptkbp:molecularWeight
|
128.17 g/mol
|
|
gptkbp:NFPA704
|
Health: 2, Flammability: 2, Instability: 0
|
|
gptkbp:productionMethod
|
Petroleum refining
Distillation of coal tar
|
|
gptkbp:PubChem_CID
|
931
CHEMBL504
CHEBI:16482
|
|
gptkbp:refractiveIndex
|
1.586 (20 °C)
|
|
gptkbp:regulates
|
Listed as hazardous air pollutant (US EPA)
Subject to workplace exposure limits
|
|
gptkbp:relatedTo
|
gptkb:Benzene
gptkb:Anthracene
gptkb:Phenanthrene
|
|
gptkbp:riskFactor
|
gptkb:H302_(Harmful_if_swallowed)
H351 (Suspected of causing cancer)
H400 (Very toxic to aquatic life)
|
|
gptkbp:routeOfExposure
|
Inhalation
Ingestion
Skin contact
|
|
gptkbp:RTECSNumber
|
QJ0525000
|
|
gptkbp:solubility
|
Soluble in organic solvents
0.031 g/L (25 °C)
|
|
gptkbp:source
|
Petroleum
Coal tar
|
|
gptkbp:structure
|
Two fused benzene rings
|
|
gptkbp:toxicity
|
Toxic to humans and animals
|
|
gptkbp:UNNumber
|
1334
|
|
gptkbp:uses
|
gptkb:solvent
Fumigant
Intermediate in dye production
Moth repellent
Precursor to phthalic anhydride
|
|
gptkbp:vaporPressure
|
0.087 mmHg (25 °C)
|
|
gptkbp:bfsParent
|
gptkb:Benzene
|
|
gptkbp:bfsLayer
|
6
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
Naphthalene
|