|
gptkbp:instanceOf
|
gptkb:drug
gptkb:p38_MAP_kinase_inhibitor
|
|
gptkbp:ATCCode
|
none (not assigned)
|
|
gptkbp:CASNumber
|
878513-46-9
|
|
gptkbp:clinicalTrialPhase
|
Phase II
|
|
gptkbp:developedBy
|
GlaxoSmithKline
|
|
gptkbp:hasMolecularFormula
|
C18H16ClF2N3O2
|
|
gptkbp:hasSMILES
|
CC1=NC(=C(C(=N1)NC2=CC=CC=C2)C3=CC(=C(C=C3)Cl)F)C(=O)N
|
|
gptkbp:intendedUse
|
treatment of COVID-19
treatment of inflammatory diseases
treatment of muscular dystrophy
|
|
gptkbp:legalStatus
|
investigational
|
|
gptkbp:mechanismOfAction
|
inhibits p38 alpha and beta mitogen-activated protein kinases
|
|
gptkbp:PubChem_CID
|
gptkb:CHEMBL2105727
11561616
|
|
gptkbp:routeOfAdministration
|
oral
|
|
gptkbp:sideEffect
|
nausea
diarrhea
headache
|
|
gptkbp:status
|
investigational
|
|
gptkbp:studiedBy
|
gptkb:acute_coronary_syndrome
gptkb:facioscapulohumeral_muscular_dystrophy
COVID-19 pneumonia
|
|
gptkbp:synonym
|
GW856553X
|
|
gptkbp:UNII
|
6Z5B6HVF6O
|
|
gptkbp:bfsParent
|
gptkb:MAPK/p38_pathway
gptkb:p38_inhibitors
|
|
gptkbp:bfsLayer
|
8
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
Losmapimod
|