| gptkbp:instanceOf | gptkb:chemical_compound 
 | 
                        
                            
                                | gptkbp:ATCCode | N06BC01 
 | 
                        
                            
                                | gptkbp:boilingPoint | 178°C (sublimes) 
 | 
                        
                            
                                | gptkbp:CASNumber | 58-08-2 
 | 
                        
                            
                                | gptkbp:color | white 
 | 
                        
                            
                                | gptkbp:contains | gptkb:café cola
 energy drinks
 
 | 
                        
                            
                                | gptkbp:drugClass | gptkb:stimulant gptkb:adenosine_receptor_antagonist
 
 | 
                        
                            
                                | gptkbp:eliminationHalfLife | 3-7 hours (adults) up to 100 hours (neonates)
 
 | 
                        
                            
                                | gptkbp:excretion | urine 
 | 
                        
                            
                                | gptkbp:flavor | gptkb:bitter 
 | 
                        
                            
                                | gptkbp:hasInChIKey | RYYVLZVUVIJVGH-UHFFFAOYSA-N 
 | 
                        
                            
                                | gptkbp:hasMolecularFormula | C8H10N4O2 
 | 
                        
                            
                                | gptkbp:hasSMILES | Cn1cnc2c1c(=O)n(C)c(=O)n2C 
 | 
                        
                            
                                | gptkbp:hasUNII | 3G6A5W338E 
 | 
                        
                            
                                | gptkbp:indication | drowsiness migraine headache
 asthma (historical)
 management of fatigue
 treatment of apnea of prematurity
 
 | 
                        
                            
                                | gptkbp:isApprovedDrug | true 
 | 
                        
                            
                                | gptkbp:IUPACName | gptkb:1,3,7-trimethylpurine-2,6-dione 
 | 
                        
                            
                                | gptkbp:legalStatus | OTC (over-the-counter) 
 | 
                        
                            
                                | gptkbp:mechanismOfAction | gptkb:phosphodiesterase_inhibitor nonselective antagonist of adenosine receptors
 
 | 
                        
                            
                                | gptkbp:meltingPoint | 238°C 
 | 
                        
                            
                                | gptkbp:metabolism | liver (CYP1A2) 
 | 
                        
                            
                                | gptkbp:molecularWeight | 194.19 
 | 
                        
                            
                                | gptkbp:pregnancyCategory | Category C (US) 
 | 
                        
                            
                                | gptkbp:proteinBinding | 36% 
 | 
                        
                            
                                | gptkbp:PubChem_CID | gptkb:DB03128 2519
 27732
 D00528
 
 | 
                        
                            
                                | gptkbp:routeOfAdministration | oral intravenous
 
 | 
                        
                            
                                | gptkbp:sideEffect | nervousness insomnia
 tachycardia
 gastrointestinal disturbance
 
 | 
                        
                            
                                | gptkbp:structureType | gptkb:xanthine_derivative 
 | 
                        
                            
                                | gptkbp:synonym | gptkb:1,3,7-Trimethylxanthine Caffeine
 
 | 
                        
                            
                                | gptkbp:toxicity | arrhythmia (overdose) seizures (overdose)
 
 | 
                        
                            
                                | gptkbp:bfsParent | gptkb:acetylcholine 
 | 
                        
                            
                                | gptkbp:bfsLayer | 7 
 | 
                        
                            
                                | https://www.w3.org/2000/01/rdf-schema#label | DB03128 
 |