Statements (26)
| Predicate | Object |
|---|---|
| gptkbp:instanceOf |
gptkb:drug
|
| gptkbp:approvedBy |
gptkb:Japan
gptkb:United_States |
| gptkbp:ATCCode |
gptkb:N05AX14
|
| gptkbp:belongsToPharmacologicalClass |
gptkb:antipsychotic_medication
|
| gptkbp:brand |
gptkb:Latuda
|
| gptkbp:CASNumber |
gptkb:162045-06-9
|
| gptkbp:developedBy |
gptkb:Sumitomo_Dainippon_Pharma
|
| gptkbp:hasInChIKey |
QXQZYYFGJIEGIV-UHFFFAOYSA-N
|
| gptkbp:hasMolecularFormula |
C28H36N4O2S
|
| gptkbp:hasSMILES |
CN1CCN(CC1)C2=NC3=CC=CC=C3C(=N2)C4=CC(=C(C=C4)S(=O)(=O)N)OCC5CCCCC5
|
| gptkbp:hasUNII |
7M546I6C95
|
| gptkbp:KEGGID |
gptkb:D08513
|
| gptkbp:legalStatus |
prescription only
|
| gptkbp:molecularWeight |
492.68 g/mol
|
| gptkbp:pregnancyCategory |
C (US)
|
| gptkbp:PubChem_CID |
gptkb:DB11799
213046 CHEMBL2108507 |
| gptkbp:routeOfAdministration |
oral
|
| gptkbp:synonym |
gptkb:Lurasidone
|
| gptkbp:usedFor |
bipolar disorder
schizophrenia |
| gptkbp:bfsParent |
gptkb:sodium_stibogluconate
|
| gptkbp:bfsLayer |
6
|
| https://www.w3.org/2000/01/rdf-schema#label |
D08513
|