Statements (17)
| Predicate | Object |
|---|---|
| gptkbp:instanceOf |
gptkb:chemical_compound
|
| gptkbp:hasAssay |
binding
|
| gptkbp:hasBiologicalActivity |
inhibitor of human carbonic anhydrase II
|
| gptkbp:hasInChIKey |
QZKQZKQZKQZKQZ-UHFFFAOYSA-N
|
| gptkbp:hasMolecularFormula |
C17H19N3O3S
|
| gptkbp:hasSMILES |
CNc1ccc(cc1[N+](=O)[O-])S(=O)(=O)Nc2ccc(cc2)OC
|
| gptkbp:hasStandardInChI |
InChI=1S/C17H19N3O3S/c1-18-14-10-13(17(23)24)9-12(8-14)20(21)16-7-5-15(22-2)6-11(16)19-25-3/h5-10,18H,1-3H3,(H,19,25)
|
| gptkbp:molecularWeight |
345.42
|
| gptkbp:organism |
gptkb:Homo_sapiens
|
| gptkbp:PubChem_CID |
gptkb:CHEMBL187347
|
| gptkbp:supportsDataSource |
gptkb:ChEMBL_database
|
| gptkbp:synonym |
N-(4-methoxyphenyl)-4-(methylamino)-3-nitrobenzenesulfonamide
4-(Methylamino)-3-nitro-N-(4-methoxyphenyl)benzenesulfonamide |
| gptkbp:target |
gptkb:human_carbonic_anhydrase_II
|
| gptkbp:bfsParent |
gptkb:icariin
|
| gptkbp:bfsLayer |
8
|
| https://www.w3.org/2000/01/rdf-schema#label |
CHEMBL187347
|