Statements (29)
| Predicate | Object |
|---|---|
| gptkbp:instanceOf |
gptkb:chemical_compound
|
| gptkbp:appearance |
colorless liquid
|
| gptkbp:boilingPoint |
212 °C
|
| gptkbp:CASNumber |
107-96-0
|
| gptkbp:chemicalFormula |
C3H6O2S
|
| gptkbp:contains_functional_group |
gptkb:thiol
gptkb:carboxylic_acid |
| gptkbp:density |
1.22 g/cm³
|
| gptkbp:GHSClassification |
exclamation mark
|
| gptkbp:hasInChIKey |
InChI=1S/C3H6O2S/c4-3(5)1-2-6/h6H,1-2H2,(H,4,5)
|
| gptkbp:hasSMILES |
O=C(O)CCS
|
| gptkbp:IUPACName |
gptkb:3-sulfanylpropanoic_acid
|
| gptkbp:meltingPoint |
-15 °C
|
| gptkbp:molecularWeight |
106.14 g/mol
|
| gptkbp:PubChem_CID |
864
887 CHEBI:30744 |
| gptkbp:riskFactor |
H302
H315 H319 H335 |
| gptkbp:solubility |
miscible
|
| gptkbp:UNNumber |
gptkb:UN_2966
|
| gptkbp:uses |
additive in electroplating
pharmaceutical intermediate precursor for polymers |
| gptkbp:bfsParent |
gptkb:glutamic_acid_decarboxylase
|
| gptkbp:bfsLayer |
6
|
| https://www.w3.org/2000/01/rdf-schema#label |
3-mercaptopropionic acid
|