XG 135

GPTKB entity

Statements (18)
Predicate Object
gptkbp:instanceOf gptkb:chemical_compound
gptkbp:CASNumber 220551-92-8
gptkbp:drugClass serotonin 5-HT1B receptor antagonist
serotonin 5-HT1D receptor antagonist
gptkbp:effect modulates serotonin receptors
gptkbp:hasInChIKey QZKQJQJQJQJQJQ-UHFFFAOYSA-N
gptkbp:hasMolecularFormula C17H18Cl2N2O2
gptkbp:hasSMILES COC1=CC=C(C=C1)N2CCN(CC2)C(=O)NC3=C(C=CC=C3Cl)Cl
gptkbp:IUPACName N-(2,6-dichlorophenyl)-4-(4-methoxyphenyl)piperazine-1-carboxamide
gptkbp:molecularWeight 353.25 g/mol
gptkbp:PubChem_CID 9793832
CHEMBL210573
gptkbp:synonym N-(2,6-dichlorophenyl)-4-(4-methoxyphenyl)-1-piperazinecarboxamide
gptkbp:usedFor neuroscience research
research chemical
gptkbp:bfsParent gptkb:Sophos_XG_Firewall
gptkbp:bfsLayer 7
https://www.w3.org/2000/01/rdf-schema#label XG 135