Statements (24)
| Predicate | Object | 
|---|---|
| gptkbp:instanceOf | gptkb:chemical_compound gptkb:drug | 
| gptkbp:approvedBy | gptkb:Japan | 
| gptkbp:ATCCode | B03XA12 | 
| gptkbp:brand | Mujinzo | 
| gptkbp:CASNumber | 1092939-17-7 | 
| gptkbp:developedBy | gptkb:Bayer | 
| gptkbp:hasInChIKey | QJQYQJXKQKJZQJ-UHFFFAOYSA-N | 
| gptkbp:hasMolecularFormula | C19H16N4O4 | 
| gptkbp:hasSMILES | C1=CC=C(C=C1)C(=O)NC2=NC(=C(N=C2C3=CC=CC=C3)C(=O)N)C(=O)O | 
| gptkbp:indication | anemia associated with chronic kidney disease | 
| gptkbp:legal_status_in_Japan | approved | 
| gptkbp:mechanismOfAction | HIF prolyl-hydroxylase inhibitor | 
| gptkbp:molecularWeight | 364.36 g/mol | 
| gptkbp:PubChem_CID | 25154816 CHEMBL2103887 | 
| gptkbp:routeOfAdministration | oral | 
| gptkbp:target | HIF prolyl-hydroxylase | 
| gptkbp:therapeuticArea | nephrology | 
| gptkbp:UNII | 6Z1Y2V4S2E | 
| gptkbp:usedFor | treatment of anemia | 
| gptkbp:bfsParent | gptkb:Servier | 
| gptkbp:bfsLayer | 7 | 
| https://www.w3.org/2000/01/rdf-schema#label | Molidustat |