Mescaline

GPTKB entity

Statements (51)
Predicate Object
gptkbp:instanceOf gptkb:Hallucinogen
gptkb:amphetamine
gptkbp:addiction_liability low
gptkbp:ATCCode none
gptkbp:boilingPoint 180-200 °C (decomposes)
gptkbp:CASNumber 54-04-6
gptkbp:category gptkb:entactogen
gptkb:Hallucinogen
gptkb:serotonin_receptor_agonist
gptkb:psychedelic_phenethylamine
plant alkaloid
gptkbp:chemicalFormula C11H17NO3
gptkbp:discoveredBy gptkb:Arthur_Heffter
gptkbp:duration_of_effects 8-12 hours
gptkbp:firstIsolatedFrom peyote cactus
gptkbp:foundIn gptkb:San_Pedro_cactus
gptkb:Lophophora_williamsii
gptkb:Peruvian_torch_cactus
gptkbp:hasInChIKey InChI=1S/C11H17NO3/c1-14-10-5-8(3-4-12)6-11(15-2)9(10)7-13/h5-7,13H,3-4,12H2,1-2H3
gptkbp:hasSMILES COC1=CC(=CC(=C1OC)OC)CCN
gptkbp:IUPACName 2-(3,4,5-trimethoxyphenyl)ethan-1-amine
gptkbp:legalStatus gptkb:Schedule_I_(US)
gptkbp:mechanismOfAction 5-HT2A receptor agonist
gptkbp:meltingPoint 35-36 °C
gptkbp:molecularWeight 211.27 g/mol
gptkbp:psychoactive euphoria
synesthesia
visual hallucinations
altered thinking
gptkbp:PubChem_CID 4076
CHEBI:6708
CHEMBL118
DB01474
gptkbp:relatedTo gptkb:DOM
gptkb:MDMA
gptkb:amphetamine
gptkbp:routeOfAdministration oral
insufflation
gptkbp:sideEffect nausea
vomiting
anxiety
increased heart rate
dilated pupils
gptkbp:toxicity low
gptkbp:UNII Y3C68E602W
gptkbp:used_in Native American religious ceremonies
gptkbp:usedFor hallucinogenic effects
gptkbp:bfsParent gptkb:Mescalito
gptkb:Hallucinogenic_Plants
gptkbp:bfsLayer 7
https://www.w3.org/2000/01/rdf-schema#label Mescaline