|
gptkbp:instanceOf
|
gptkb:drug
|
|
gptkbp:ATCCode
|
J05AB16
|
|
gptkbp:bioavailability
|
low (prodrug, IV only)
|
|
gptkbp:CASNumber
|
1809249-37-3
|
|
gptkbp:category
|
gptkb:nucleotide
gptkb:prodrug
antiviral
|
|
gptkbp:contraindication
|
hypersensitivity to remdesivir
|
|
gptkbp:drugClass
|
gptkb:antiviral_drug
|
|
gptkbp:drugInteraction
|
chloroquine
hydroxychloroquine
|
|
gptkbp:eliminatedIn
|
renal (metabolites)
|
|
gptkbp:eliminationHalfLife
|
1 hour (parent), 25 hours (metabolite)
|
|
gptkbp:hasFirstApprovalDate
|
2020-05-01
|
|
gptkbp:hasInChIKey
|
RWWYLEGWBNMMLJ-YSOARWBDSA-N
|
|
gptkbp:hasMolecularFormula
|
C27H35N6O8P
|
|
gptkbp:hasPatent
|
US20170071964A1
|
|
gptkbp:hasSMILES
|
CC(C)[C@@H](NC(=O)[C@@H](N)C(C)C)P(=O)(OCC1=CN(C2=CC=CC=C21)C3=NC=NC=C3)OCC4=CN(C5=CC=CC=C45)C6=NC=NC=C6
|
|
gptkbp:hasStorageCondition
|
store below 30°C
|
|
gptkbp:hasUNII
|
53J0A3T31S
|
|
gptkbp:indication
|
gptkb:COVID-19
gptkb:Ebola_virus_infection_(investigational)
|
|
gptkbp:legalStatus
|
prescription only
|
|
gptkbp:manufacturer
|
gptkb:Gilead_Sciences
|
|
gptkbp:mechanismOfAction
|
RNA polymerase inhibitor
|
|
gptkbp:metabolism
|
hepatic
|
|
gptkbp:molecularWeight
|
602.6 g/mol
|
|
gptkbp:name
|
gptkb:Remdesivir
|
|
gptkbp:pregnancyCategory
|
Not assigned
|
|
gptkbp:proteinBinding
|
88-93%
|
|
gptkbp:PubChem_CID
|
gptkb:DB12983
121304016
CHEMBL2016761
D11472
58191791
|
|
gptkbp:routeOfAdministration
|
intravenous
|
|
gptkbp:sideEffect
|
nausea
elevated liver enzymes
hypersensitivity
|
|
gptkbp:status
|
FDA approved
EMA approved
|
|
gptkbp:synonym
|
gptkb:GS-5734
|
|
gptkbp:target
|
RNA-dependent RNA polymerase
|
|
gptkbp:bfsParent
|
gptkb:tazemetostat
|
|
gptkbp:bfsLayer
|
8
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
DB12983
|