Statements (26)
| Predicate | Object |
|---|---|
| gptkbp:instanceOf |
gptkb:drug
|
| gptkbp:approvalYear |
2018
|
| gptkbp:approvedBy |
gptkb:Japan
gptkb:United_States |
| gptkbp:ATCCode |
J05AX25
|
| gptkbp:CASNumber |
1985606-14-1
|
| gptkbp:developer |
gptkb:Roche
gptkb:Shionogi |
| gptkbp:hasMolecularFormula |
C27H23F2N3O7
|
| gptkbp:hasSMILES |
CC1=C(C(=O)N(C(=O)N1C2=CC=CC=C2)C3=CC=C(C=C3)F)C(=O)OCC4=CC=CC=C4F
|
| gptkbp:legalStatus |
prescription only
|
| gptkbp:mechanismOfAction |
cap-dependent endonuclease inhibitor
|
| gptkbp:molecularWeight |
571.5 g/mol
|
| gptkbp:name |
gptkb:Baloxavir_marboxil
|
| gptkbp:pregnancyCategory |
Not assigned (US)
|
| gptkbp:PubChem_CID |
gptkb:DB11701
124081317 |
| gptkbp:routeOfAdministration |
oral
|
| gptkbp:synonym |
gptkb:Xofluza
S-033188 |
| gptkbp:target |
gptkb:influenza_virus_polymerase_acidic_protein
|
| gptkbp:usedFor |
gptkb:influenza_A
gptkb:influenza_B |
| gptkbp:bfsParent |
gptkb:ribociclib
|
| gptkbp:bfsLayer |
8
|
| https://www.w3.org/2000/01/rdf-schema#label |
DB11701
|