|
gptkbp:instanceOf
|
gptkb:drug
|
|
gptkbp:approvalYear
|
2020
|
|
gptkbp:ATCCode
|
J05AB16
|
|
gptkbp:bioavailability
|
intravenous only
|
|
gptkbp:brand
|
gptkb:Veklury
|
|
gptkbp:CASNumber
|
1809249-37-3
|
|
gptkbp:category
|
gptkb:antiviral_drug
gptkb:prodrug
antiviral
|
|
gptkbp:contraindication
|
hypersensitivity to remdesivir
|
|
gptkbp:developer
|
gptkb:Gilead_Sciences
|
|
gptkbp:drugClass
|
gptkb:antiviral_drug
|
|
gptkbp:eliminatedIn
|
renal
fecal
|
|
gptkbp:eliminationHalfLife
|
1 hour (plasma), 25 hours (metabolite)
|
|
gptkbp:hasAdministrationForm
|
solution for infusion
|
|
gptkbp:hasBoxedWarning
|
hypersensitivity reactions
|
|
gptkbp:hasInChIKey
|
RWWYLEGWBNMMLJ-YSOARWBDSA-N
|
|
gptkbp:hasLactationRisk
|
gptkb:unknown
|
|
gptkbp:hasMolecularFormula
|
C27H35N6O8P
|
|
gptkbp:hasPatent
|
US20150361013A1
|
|
gptkbp:hasPharmacodynamics
|
inhibits viral replication
|
|
gptkbp:hasPregnancyCategoryUS
|
Not assigned
|
|
gptkbp:hasSMILES
|
CC(C)[C@@H](NC(=O)[C@@H](COP(=O)(OCC1=CN=CN1C)O)O)C(=O)N[C@H](C)C(=O)O
|
|
gptkbp:hasStorageCondition
|
Store below 30°C
|
|
gptkbp:hasUNII
|
53J0WS6OJ7
|
|
gptkbp:indication
|
gptkb:COVID-19
gptkb:Ebola_virus_infection_(investigational)
|
|
gptkbp:legalStatus
|
Prescription only
|
|
gptkbp:mechanismOfAction
|
RNA polymerase inhibitor
|
|
gptkbp:metabolism
|
hydrolyzed to GS-441524
|
|
gptkbp:molecularWeight
|
602.6 g/mol
|
|
gptkbp:name
|
gptkb:Remdesivir
|
|
gptkbp:pregnancyCategory
|
Not assigned
|
|
gptkbp:proteinBinding
|
88-93%
|
|
gptkbp:PubChem_CID
|
gptkb:DB11599
121304016
CHEMBL2016761
D11472
58828032
|
|
gptkbp:routeOfAdministration
|
intravenous
|
|
gptkbp:sideEffect
|
nausea
elevated liver enzymes
hypersensitivity
|
|
gptkbp:status
|
FDA approved
EMA approved
|
|
gptkbp:synonym
|
gptkb:GS-5734
|
|
gptkbp:target
|
RNA-dependent RNA polymerase
|
|
gptkbp:therapeuticArea
|
gptkb:disease
|
|
gptkbp:bfsParent
|
gptkb:obeticholic_acid
|
|
gptkbp:bfsLayer
|
6
|
|
https://www.w3.org/2000/01/rdf-schema#label
|
DB11599
|