4-aminobenzoic acid

GPTKB entity

Statements (32)
Predicate Object
gptkbp:instanceOf gptkb:chemical_compound
gptkb:aromatic_amine
gptkb:benzoic_acid_derivative
gptkbp:appearance white to off-white crystalline powder
gptkbp:boilingPoint Not applicable (decomposes)
gptkbp:CASNumber 150-13-0
gptkbp:category Aminobenzoic acids
Aromatic acids
gptkbp:chemicalFormula C7H7NO2
gptkbp:density 1.374 g/cm³
gptkbp:foundIn vitamin B complex (sometimes classified as B10)
gptkbp:hasInChIKey InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)
gptkbp:hasSMILES C1=CC(=CC=C1C(=O)O)N
gptkbp:IUPACName gptkb:4-aminobenzoic_acid
gptkbp:meltingPoint 187 °C
gptkbp:molecularWeight 137.14 g/mol
gptkbp:otherName gptkb:para-aminobenzoic_acid
PABA
gptkbp:PubChem_CID 978
CHEBI:30753
gptkbp:relatedTo folic acid
benzoic acid
aniline
gptkbp:solubility slightly soluble
gptkbp:structure benzene ring with amino group at para position and carboxylic acid group
gptkbp:uses pharmaceuticals
dye manufacturing
intermediate in folic acid synthesis
sunscreen ingredient (historically)
gptkbp:bfsParent gptkb:Paba
gptkbp:bfsLayer 7
https://www.w3.org/2000/01/rdf-schema#label 4-aminobenzoic acid