Statements (32)
| Predicate | Object |
|---|---|
| gptkbp:instanceOf |
gptkb:chemical_compound
gptkb:aromatic_amine gptkb:benzoic_acid_derivative |
| gptkbp:appearance |
white to off-white crystalline powder
|
| gptkbp:boilingPoint |
Not applicable (decomposes)
|
| gptkbp:CASNumber |
150-13-0
|
| gptkbp:category |
Aminobenzoic acids
Aromatic acids |
| gptkbp:chemicalFormula |
C7H7NO2
|
| gptkbp:density |
1.374 g/cm³
|
| gptkbp:foundIn |
vitamin B complex (sometimes classified as B10)
|
| gptkbp:hasInChIKey |
InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)
|
| gptkbp:hasSMILES |
C1=CC(=CC=C1C(=O)O)N
|
| gptkbp:IUPACName |
gptkb:4-aminobenzoic_acid
|
| gptkbp:meltingPoint |
187 °C
|
| gptkbp:molecularWeight |
137.14 g/mol
|
| gptkbp:otherName |
gptkb:para-aminobenzoic_acid
PABA |
| gptkbp:PubChem_CID |
978
CHEBI:30753 |
| gptkbp:relatedTo |
folic acid
benzoic acid aniline |
| gptkbp:solubility |
slightly soluble
|
| gptkbp:structure |
benzene ring with amino group at para position and carboxylic acid group
|
| gptkbp:uses |
pharmaceuticals
dye manufacturing intermediate in folic acid synthesis sunscreen ingredient (historically) |
| gptkbp:bfsParent |
gptkb:Paba
|
| gptkbp:bfsLayer |
7
|
| https://www.w3.org/2000/01/rdf-schema#label |
4-aminobenzoic acid
|