Statements (28)
| Predicate | Object | 
|---|---|
| gptkbp:instanceOf | gptkb:chemical_compound | 
| gptkbp:appearance | yellow crystalline solid | 
| gptkbp:CASNumber | 51-28-5 | 
| gptkbp:category | gptkb:nitrophenols toxic substances uncouplers of oxidative phosphorylation | 
| gptkbp:chemicalFormula | C6H4N2O5 | 
| gptkbp:hasInChIKey | InChI=1S/C6H4N2O5/c9-5-1-3(7(11)12)2-6(10)4(5)8(13)14/h1-2H | 
| gptkbp:hasSMILES | C1=CC(=C(C=C1N(=O)=O)N(=O)=O)O | 
| gptkbp:KEGGID | C07341 | 
| gptkbp:mechanismOfAction | uncouples oxidative phosphorylation | 
| gptkbp:meltingPoint | 112 °C | 
| gptkbp:molecularWeight | 184.11 g/mol | 
| gptkbp:PubChem_CID | 1494 CHEBI:27728 | 
| gptkbp:relatedTo | gptkb:dinitrophenol | 
| gptkbp:riskFactor | H301 (toxic if swallowed) H373 (may cause damage to organs through prolonged or repeated exposure) H311 (toxic in contact with skin) H331 (toxic if inhaled) | 
| gptkbp:solubility | slightly soluble | 
| gptkbp:toxicity | highly toxic | 
| gptkbp:UNNumber | 0076 | 
| gptkbp:uses | gptkb:herbicide weight loss agent (illicit) | 
| gptkbp:bfsParent | gptkb:Picrin | 
| gptkbp:bfsLayer | 6 | 
| https://www.w3.org/2000/01/rdf-schema#label | 2,4-dinitrophenol |